About 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile
3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile (PubChem CID 58583764) has the molecular formula C22H16N2S2
and a molecular weight of 372.52 g/mol. Its IUPAC name is 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile |
| PubChem CID | 58583764 |
| Molecular Formula | C22H16N2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile |
| SMILES | Cc1ccccc1Sc1ccc(Sc2ccccc2C)c(C#N)c1C#N |
| InChI | InChI=1S/C22H16N2S2/c1-15-7-3-5-9-19(15)25-21-11-12-22(18(14-24)17(21)13-23)26-20-10-6-4-8-16(20)2/h3-12H,1-2H3 |
| InChIKey | RMAYCPMICCZYCX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile?
The IUPAC name of 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile (CID 58583764) is 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile.
What is the SMILES notation for 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile?
The canonical SMILES for 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile is Cc1ccccc1Sc1ccc(Sc2ccccc2C)c(C#N)c1C#N.
What is the InChIKey of 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile?
The InChIKey is RMAYCPMICCZYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2S2/c1-15-7-3-5-9-19(15)25-21-11-12-22(18(14-24)17(21)13-23)26-20-10-6-4-8-16(20)2/h3-12H,1-2H3.
What are the key properties of 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile?
3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile has a molecular weight of 372.52 g/mol, XLogP of 6.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis[(2-methylphenyl)sulfanyl]benzene-1,2-dicarbonitrile is sourced from PubChem (CID 58583764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).