About 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine
3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine (PubChem CID 58583910) has the molecular formula C25H20N2
and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine.
Molecular Properties
| Compound Name | 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine |
| PubChem CID | 58583910 |
| Molecular Formula | C25H20N2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine |
| SMILES | CC1(C)c2cc(-c3cccnc3)ccc2-c2ccc(-c3cccnc3)cc21 |
| InChI | InChI=1S/C25H20N2/c1-25(2)23-13-17(19-5-3-11-26-15-19)7-9-21(23)22-10-8-18(14-24(22)25)20-6-4-12-27-16-20/h3-16H,1-2H3 |
| InChIKey | FXQWQEDSGWAVCK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine?
The IUPAC name of 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine (CID 58583910) is 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine.
What is the SMILES notation for 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine?
The canonical SMILES for 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine is CC1(C)c2cc(-c3cccnc3)ccc2-c2ccc(-c3cccnc3)cc21.
What is the InChIKey of 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine?
The InChIKey is FXQWQEDSGWAVCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N2/c1-25(2)23-13-17(19-5-3-11-26-15-19)7-9-21(23)22-10-8-18(14-24(22)25)20-6-4-12-27-16-20/h3-16H,1-2H3.
What are the key properties of 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine?
3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine has a molecular weight of 348.45 g/mol, XLogP of 6.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(9,9-dimethyl-7-pyridin-3-ylfluoren-2-yl)pyridine is sourced from PubChem (CID 58583910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).