About N-propan-2-yl-1,6-naphthyridin-3-amine
N-propan-2-yl-1,6-naphthyridin-3-amine (PubChem CID 58584184) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is N-propan-2-yl-1,6-naphthyridin-3-amine.
Molecular Properties
| Compound Name | N-propan-2-yl-1,6-naphthyridin-3-amine |
| PubChem CID | 58584184 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | N-propan-2-yl-1,6-naphthyridin-3-amine |
| SMILES | CC(C)Nc1cnc2ccncc2c1 |
| InChI | InChI=1S/C11H13N3/c1-8(2)14-10-5-9-6-12-4-3-11(9)13-7-10/h3-8,14H,1-2H3 |
| InChIKey | QRAQYEMVTWJSOA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-propan-2-yl-1,6-naphthyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-1,6-naphthyridin-3-amine?
The IUPAC name of N-propan-2-yl-1,6-naphthyridin-3-amine (CID 58584184) is N-propan-2-yl-1,6-naphthyridin-3-amine.
What is the SMILES notation for N-propan-2-yl-1,6-naphthyridin-3-amine?
The canonical SMILES for N-propan-2-yl-1,6-naphthyridin-3-amine is CC(C)Nc1cnc2ccncc2c1.
What is the InChIKey of N-propan-2-yl-1,6-naphthyridin-3-amine?
The InChIKey is QRAQYEMVTWJSOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c1-8(2)14-10-5-9-6-12-4-3-11(9)13-7-10/h3-8,14H,1-2H3.
What are the key properties of N-propan-2-yl-1,6-naphthyridin-3-amine?
N-propan-2-yl-1,6-naphthyridin-3-amine has a molecular weight of 187.25 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-1,6-naphthyridin-3-amine is sourced from PubChem (CID 58584184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).