About N-propan-2-yl-1,2,3-benzothiadiazol-6-amine
N-propan-2-yl-1,2,3-benzothiadiazol-6-amine (PubChem CID 58584208) has the molecular formula C9H11N3S
and a molecular weight of 193.27 g/mol. Its IUPAC name is N-propan-2-yl-1,2,3-benzothiadiazol-6-amine.
Molecular Properties
| Compound Name | N-propan-2-yl-1,2,3-benzothiadiazol-6-amine |
| PubChem CID | 58584208 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | N-propan-2-yl-1,2,3-benzothiadiazol-6-amine |
| SMILES | CC(C)Nc1ccc2nnsc2c1 |
| InChI | InChI=1S/C9H11N3S/c1-6(2)10-7-3-4-8-9(5-7)13-12-11-8/h3-6,10H,1-2H3 |
| InChIKey | MPBSIBMQLDWMKU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-propan-2-yl-1,2,3-benzothiadiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-1,2,3-benzothiadiazol-6-amine?
The IUPAC name of N-propan-2-yl-1,2,3-benzothiadiazol-6-amine (CID 58584208) is N-propan-2-yl-1,2,3-benzothiadiazol-6-amine.
What is the SMILES notation for N-propan-2-yl-1,2,3-benzothiadiazol-6-amine?
The canonical SMILES for N-propan-2-yl-1,2,3-benzothiadiazol-6-amine is CC(C)Nc1ccc2nnsc2c1.
What is the InChIKey of N-propan-2-yl-1,2,3-benzothiadiazol-6-amine?
The InChIKey is MPBSIBMQLDWMKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3S/c1-6(2)10-7-3-4-8-9(5-7)13-12-11-8/h3-6,10H,1-2H3.
What are the key properties of N-propan-2-yl-1,2,3-benzothiadiazol-6-amine?
N-propan-2-yl-1,2,3-benzothiadiazol-6-amine has a molecular weight of 193.27 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-1,2,3-benzothiadiazol-6-amine is sourced from PubChem (CID 58584208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).