C72H51MnN8O6Ra+ — CID 58584373
CID 58584373 (PubChem CID 58584373) has the molecular formula C72H51MnN8O6Ra+ and a molecular weight of 1405.19 g/mol.
| Compound Name | CID 58584373 |
|---|---|
| PubChem CID | 58584373 |
| Molecular Formula | C72H51MnN8O6Ra+ |
| Molecular Weight | 1405.19 g/mol |
| Exact Mass | 1404.36 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C[n+]2ccccc2-c2c3nc(c(-c4cccc[n+]4Cc4cccc(C(=O)[O-])c4)c4ccc([n-]4)c(-c4cccc[n+]4Cc4cccc(C(=O)[O-])c4)c4nc(c(-c5cccc[n+]5Cc5cccc(C(=O)[O-])c5)c5ccc2[n-]5)C=C4)C=C3)c1.[Mn+2].[Ra] |
| InChI | InChI=1S/C72H52N8O6.Mn.Ra/c1-46-14-10-15-47(38-46)42-77-34-6-2-22-62(77)66-54-26-28-56(73-54)67(63-23-3-7-35-78(63)43-48-16-11-19-51(39-48)70(81)82)58-30-32-60(75-58)69(65-25-5-9-37-80(65)45-50-18-13-21-53(41-50)72(85)86)61-33-31-59(76-61)68(57-29-27-55(66)74-57)64-24-4-8-36-79(64)44-49-17-12-20-52(40-49)71(83)84;;/h2-41H,42-45H2,1H3,(H-3,73,74,75,76,81,82,83,84,85,86);;/q;+2;/p-1/b66-54+,66-55+,67-56+,67-58+,68-57+,68-59+,69-60+,69-61+;; |
| InChIKey | RRCPTWYLVPTZDF-KFKOZBNGSA-M |
| XLogP | 7.32 |
| TPSA | 189.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1405.19 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|