About 6-propan-2-yl-1,6-diazaspiro[2.5]octane
6-propan-2-yl-1,6-diazaspiro[2.5]octane (PubChem CID 58584452) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 6-propan-2-yl-1,6-diazaspiro[2.5]octane.
Molecular Properties
| Compound Name | 6-propan-2-yl-1,6-diazaspiro[2.5]octane |
| PubChem CID | 58584452 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 6-propan-2-yl-1,6-diazaspiro[2.5]octane |
| SMILES | CC(C)N1CCC2(CC1)CN2 |
| InChI | InChI=1S/C9H18N2/c1-8(2)11-5-3-9(4-6-11)7-10-9/h8,10H,3-7H2,1-2H3 |
| InChIKey | IDKMDPNFDGDHFW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 25.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-propan-2-yl-1,6-diazaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-1,6-diazaspiro[2.5]octane?
The IUPAC name of 6-propan-2-yl-1,6-diazaspiro[2.5]octane (CID 58584452) is 6-propan-2-yl-1,6-diazaspiro[2.5]octane.
What is the SMILES notation for 6-propan-2-yl-1,6-diazaspiro[2.5]octane?
The canonical SMILES for 6-propan-2-yl-1,6-diazaspiro[2.5]octane is CC(C)N1CCC2(CC1)CN2.
What is the InChIKey of 6-propan-2-yl-1,6-diazaspiro[2.5]octane?
The InChIKey is IDKMDPNFDGDHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-8(2)11-5-3-9(4-6-11)7-10-9/h8,10H,3-7H2,1-2H3.
What are the key properties of 6-propan-2-yl-1,6-diazaspiro[2.5]octane?
6-propan-2-yl-1,6-diazaspiro[2.5]octane has a molecular weight of 154.26 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-1,6-diazaspiro[2.5]octane is sourced from PubChem (CID 58584452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).