C21H17N5O3 — CID 58584583
1-(4-methoxy-6-naphthalen-2-yloxy-1,3,5-triazin-2-yl)-3-phenylurea (PubChem CID 58584583) has the molecular formula C21H17N5O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is 1-(4-methoxy-6-naphthalen-2-yloxy-1,3,5-triazin-2-yl)-3-phenylurea.
| Compound Name | 1-(4-methoxy-6-naphthalen-2-yloxy-1,3,5-triazin-2-yl)-3-phenylurea |
|---|---|
| PubChem CID | 58584583 |
| Molecular Formula | C21H17N5O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-(4-methoxy-6-naphthalen-2-yloxy-1,3,5-triazin-2-yl)-3-phenylurea |
| SMILES | COc1nc(NC(=O)Nc2ccccc2)nc(Oc2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C21H17N5O3/c1-28-20-24-18(23-19(27)22-16-9-3-2-4-10-16)25-21(26-20)29-17-12-11-14-7-5-6-8-15(14)13-17/h2-13H,1H3,(H2,22,23,24,25,26,27) |
| InChIKey | MJRSYWKQYWXJQX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |