C20H19ClN4O3S — CID 58584803
2-(3-chloroquinoxalin-2-yl)-N-(2-methoxyethyl)-N-methyl-1H-indole-5-sulfonamide (PubChem CID 58584803) has the molecular formula C20H19ClN4O3S and a molecular weight of 430.92 g/mol. Its IUPAC name is 2-(3-chloroquinoxalin-2-yl)-N-(2-methoxyethyl)-N-methyl-1H-indole-5-sulfonamide.
| Compound Name | 2-(3-chloroquinoxalin-2-yl)-N-(2-methoxyethyl)-N-methyl-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 58584803 |
| Molecular Formula | C20H19ClN4O3S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-(3-chloroquinoxalin-2-yl)-N-(2-methoxyethyl)-N-methyl-1H-indole-5-sulfonamide |
| SMILES | COCCN(C)S(=O)(=O)c1ccc2[nH]c(-c3nc4ccccc4nc3Cl)cc2c1 |
| InChI | InChI=1S/C20H19ClN4O3S/c1-25(9-10-28-2)29(26,27)14-7-8-15-13(11-14)12-18(22-15)19-20(21)24-17-6-4-3-5-16(17)23-19/h3-8,11-12,22H,9-10H2,1-2H3 |
| InChIKey | IZNGNMVQEGTKEG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |