C28H28ClN5O3 — CID 58585379
4-[4-(3-aminophenyl)phenoxy]-2-(4-chlorophenyl)-5-[4-(2-hydroxyethyl)piperazin-1-yl]pyridazin-3-one (PubChem CID 58585379) has the molecular formula C28H28ClN5O3 and a molecular weight of 518.02 g/mol. Its IUPAC name is 4-[4-(3-aminophenyl)phenoxy]-2-(4-chlorophenyl)-5-[4-(2-hydroxyethyl)piperazin-1-yl]pyridazin-3-one.
| Compound Name | 4-[4-(3-aminophenyl)phenoxy]-2-(4-chlorophenyl)-5-[4-(2-hydroxyethyl)piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 58585379 |
| Molecular Formula | C28H28ClN5O3 |
| Molecular Weight | 518.02 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 4-[4-(3-aminophenyl)phenoxy]-2-(4-chlorophenyl)-5-[4-(2-hydroxyethyl)piperazin-1-yl]pyridazin-3-one |
| SMILES | Nc1cccc(-c2ccc(Oc3c(N4CCN(CCO)CC4)cnn(-c4ccc(Cl)cc4)c3=O)cc2)c1 |
| InChI | InChI=1S/C28H28ClN5O3/c29-22-6-8-24(9-7-22)34-28(36)27(26(19-31-34)33-14-12-32(13-15-33)16-17-35)37-25-10-4-20(5-11-25)21-2-1-3-23(30)18-21/h1-11,18-19,35H,12-17,30H2 |
| InChIKey | QWYNKHRZUQJWDR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.02 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|