C18H18ClN3O2 — CID 58585649
(2S,10S)-10-amino-8-chloro-2-(4-methoxyphenyl)-1,3-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-4-one (PubChem CID 58585649) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is (2S,10S)-10-amino-8-chloro-2-(4-methoxyphenyl)-1,3-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-4-one.
| Compound Name | (2S,10S)-10-amino-8-chloro-2-(4-methoxyphenyl)-1,3-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-4-one |
|---|---|
| PubChem CID | 58585649 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (2S,10S)-10-amino-8-chloro-2-(4-methoxyphenyl)-1,3-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-4-one |
| SMILES | COc1ccc([C@H]2NC(=O)c3ccc(Cl)c4c3N2CC[C@@H]4N)cc1 |
| InChI | InChI=1S/C18H18ClN3O2/c1-24-11-4-2-10(3-5-11)17-21-18(23)12-6-7-13(19)15-14(20)8-9-22(17)16(12)15/h2-7,14,17H,8-9,20H2,1H3,(H,21,23)/t14-,17-/m0/s1 |
| InChIKey | WUEIEWFEDZNVGU-YOEHRIQHSA-N |
| XLogP | 3.00 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |