About N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine
N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine (PubChem CID 58585712) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine |
| PubChem CID | 58585712 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine |
| SMILES | CCN(C)CC(C)COC |
| InChI | InChI=1S/C8H19NO/c1-5-9(3)6-8(2)7-10-4/h8H,5-7H2,1-4H3 |
| InChIKey | WPAPTJPWUOLPFB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine?
The IUPAC name of N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine (CID 58585712) is N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine.
What is the SMILES notation for N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine?
The canonical SMILES for N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine is CCN(C)CC(C)COC.
What is the InChIKey of N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine?
The InChIKey is WPAPTJPWUOLPFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO/c1-5-9(3)6-8(2)7-10-4/h8H,5-7H2,1-4H3.
What are the key properties of N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine?
N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine has a molecular weight of 145.25 g/mol, XLogP of 1.22, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-methoxy-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 58585712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).