C33H29NO9 — CID 58585966
1-O-tert-butyl 4-O,6-O-dimethyl 3-[(1,3-dioxoinden-2-yl)oxymethyl]-2-phenylindole-1,4,6-tricarboxylate (PubChem CID 58585966) has the molecular formula C33H29NO9 and a molecular weight of 583.59 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O,6-O-dimethyl 3-[(1,3-dioxoinden-2-yl)oxymethyl]-2-phenylindole-1,4,6-tricarboxylate.
| Compound Name | 1-O-tert-butyl 4-O,6-O-dimethyl 3-[(1,3-dioxoinden-2-yl)oxymethyl]-2-phenylindole-1,4,6-tricarboxylate |
|---|---|
| PubChem CID | 58585966 |
| Molecular Formula | C33H29NO9 |
| Molecular Weight | 583.59 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | 1-O-tert-butyl 4-O,6-O-dimethyl 3-[(1,3-dioxoinden-2-yl)oxymethyl]-2-phenylindole-1,4,6-tricarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)c2c(COC3C(=O)c4ccccc4C3=O)c(-c3ccccc3)n(C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C33H29NO9/c1-33(2,3)43-32(39)34-24-16-19(30(37)40-4)15-22(31(38)41-5)25(24)23(26(34)18-11-7-6-8-12-18)17-42-29-27(35)20-13-9-10-14-21(20)28(29)36/h6-16,29H,17H2,1-5H3 |
| InChIKey | JJLUJXOHOAVUCA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 127.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|