C26H45NO3 — CID 58586118
(4Z,6Z,8E)-3-hydroxy-N-(6-hydroxy-7-methyloctyl)-2,2,4,10,11-pentamethyldodeca-4,6,8,10-tetraenamide (PubChem CID 58586118) has the molecular formula C26H45NO3 and a molecular weight of 419.65 g/mol. Its IUPAC name is (4Z,6Z,8E)-3-hydroxy-N-(6-hydroxy-7-methyloctyl)-2,2,4,10,11-pentamethyldodeca-4,6,8,10-tetraenamide.
| Compound Name | (4Z,6Z,8E)-3-hydroxy-N-(6-hydroxy-7-methyloctyl)-2,2,4,10,11-pentamethyldodeca-4,6,8,10-tetraenamide |
|---|---|
| PubChem CID | 58586118 |
| Molecular Formula | C26H45NO3 |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 419.34 |
| IUPAC Name | (4Z,6Z,8E)-3-hydroxy-N-(6-hydroxy-7-methyloctyl)-2,2,4,10,11-pentamethyldodeca-4,6,8,10-tetraenamide |
| SMILES | CC(C)=C(C)/C=C/C=C\C=C(\C)C(O)C(C)(C)C(=O)NCCCCCC(O)C(C)C |
| InChI | InChI=1S/C26H45NO3/c1-19(2)21(5)15-11-9-12-16-22(6)24(29)26(7,8)25(30)27-18-14-10-13-17-23(28)20(3)4/h9,11-12,15-16,20,23-24,28-29H,10,13-14,17-18H2,1-8H3,(H,27,30)/b12-9-,15-11+,22-16- |
| InChIKey | OKRKWTZEJYBBLT-OPHNKPOXSA-N |
| XLogP | 5.48 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|