C26H40NO3Y- — CID 58586119
(4Z,6Z,8E)-3-hydroxy-N-[(2E,4E)-6-hydroxy-7-methanidylocta-2,4-dienyl]-2,2,4,10,11-pentamethyldodeca-4,6,8,10-tetraenamide;yttrium (PubChem CID 58586119) has the molecular formula C26H40NO3Y- and a molecular weight of 503.52 g/mol. Its IUPAC name is (4Z,6Z,8E)-3-hydroxy-N-[(2E,4E)-6-hydroxy-7-methanidylocta-2,4-dienyl]-2,2,4,10,11-pentamethyldodeca-4,6,8,10-tetraenamide;yttrium.
| Compound Name | (4Z,6Z,8E)-3-hydroxy-N-[(2E,4E)-6-hydroxy-7-methanidylocta-2,4-dienyl]-2,2,4,10,11-pentamethyldodeca-4,6,8,10-tetraenamide;yttrium |
|---|---|
| PubChem CID | 58586119 |
| Molecular Formula | C26H40NO3Y- |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | (4Z,6Z,8E)-3-hydroxy-N-[(2E,4E)-6-hydroxy-7-methanidylocta-2,4-dienyl]-2,2,4,10,11-pentamethyldodeca-4,6,8,10-tetraenamide;yttrium |
| SMILES | [CH2-]C(C)C(O)/C=C/C=C/CNC(=O)C(C)(C)C(O)/C(C)=C\C=C/C=C/C(C)=C(C)C.[Y] |
| InChI | InChI=1S/C26H40NO3.Y/c1-19(2)21(5)15-11-9-12-16-22(6)24(29)26(7,8)25(30)27-18-14-10-13-17-23(28)20(3)4;/h9-17,20,23-24,28-29H,3,18H2,1-2,4-8H3,(H,27,30);/q-1;/b12-9-,14-10+,15-11+,17-13+,22-16-; |
| InChIKey | HHDHOLSWVQUJMR-SXKOWKCYSA-N |
| XLogP | 4.85 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|