C15H30NO4+ — CID 58587057
2-(5-methoxy-2,2,4,4-tetramethyl-5-oxopentanoyl)oxyethyl-trimethylazanium (PubChem CID 58587057) has the molecular formula C15H30NO4+ and a molecular weight of 288.41 g/mol. Its IUPAC name is 2-(5-methoxy-2,2,4,4-tetramethyl-5-oxopentanoyl)oxyethyl-trimethylazanium.
| Compound Name | 2-(5-methoxy-2,2,4,4-tetramethyl-5-oxopentanoyl)oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 58587057 |
| Molecular Formula | C15H30NO4+ |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-(5-methoxy-2,2,4,4-tetramethyl-5-oxopentanoyl)oxyethyl-trimethylazanium |
| SMILES | COC(=O)C(C)(C)CC(C)(C)C(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C15H30NO4/c1-14(2,12(17)19-8)11-15(3,4)13(18)20-10-9-16(5,6)7/h9-11H2,1-8H3/q+1 |
| InChIKey | RELDYFDFQCUGCY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|