C16H24Br2O2 — CID 58587089
4a,5-bis(bromomethyl)-2-methoxy-3-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one (PubChem CID 58587089) has the molecular formula C16H24Br2O2 and a molecular weight of 408.17 g/mol. Its IUPAC name is 4a,5-bis(bromomethyl)-2-methoxy-3-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one.
| Compound Name | 4a,5-bis(bromomethyl)-2-methoxy-3-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
|---|---|
| PubChem CID | 58587089 |
| Molecular Formula | C16H24Br2O2 |
| Molecular Weight | 408.17 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 4a,5-bis(bromomethyl)-2-methoxy-3-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
| SMILES | C=C(C)C1CC2(CBr)C(CBr)CCCC2C(=O)C1OC |
| InChI | InChI=1S/C16H24Br2O2/c1-10(2)12-7-16(9-18)11(8-17)5-4-6-13(16)14(19)15(12)20-3/h11-13,15H,1,4-9H2,2-3H3 |
| InChIKey | JRSVBUYSSPXFNU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.17 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|