C19H28O2 — CID 58587091
3-(cyclohexen-1-yl)-2-methoxy-4a,5-dimethyl-2,3,4,5,6,8a-hexahydronaphthalen-1-one (PubChem CID 58587091) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)-2-methoxy-4a,5-dimethyl-2,3,4,5,6,8a-hexahydronaphthalen-1-one.
| Compound Name | 3-(cyclohexen-1-yl)-2-methoxy-4a,5-dimethyl-2,3,4,5,6,8a-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 58587091 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 3-(cyclohexen-1-yl)-2-methoxy-4a,5-dimethyl-2,3,4,5,6,8a-hexahydronaphthalen-1-one |
| SMILES | COC1C(=O)C2C=CCC(C)C2(C)CC1C1=CCCCC1 |
| InChI | InChI=1S/C19H28O2/c1-13-8-7-11-16-17(20)18(21-3)15(12-19(13,16)2)14-9-5-4-6-10-14/h7,9,11,13,15-16,18H,4-6,8,10,12H2,1-3H3 |
| InChIKey | SYGGUCQVMSMSTG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|