C15H22S2 — CID 58587136
4a,5-dimethyl-3-prop-1-en-2-yl-2-sulfanyl-2,3,4,5,6,8a-hexahydronaphthalene-1-thione (PubChem CID 58587136) has the molecular formula C15H22S2 and a molecular weight of 266.48 g/mol. Its IUPAC name is 4a,5-dimethyl-3-prop-1-en-2-yl-2-sulfanyl-2,3,4,5,6,8a-hexahydronaphthalene-1-thione.
| Compound Name | 4a,5-dimethyl-3-prop-1-en-2-yl-2-sulfanyl-2,3,4,5,6,8a-hexahydronaphthalene-1-thione |
|---|---|
| PubChem CID | 58587136 |
| Molecular Formula | C15H22S2 |
| Molecular Weight | 266.48 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4a,5-dimethyl-3-prop-1-en-2-yl-2-sulfanyl-2,3,4,5,6,8a-hexahydronaphthalene-1-thione |
| SMILES | C=C(C)C1CC2(C)C(C)CC=CC2C(=S)C1S |
| InChI | InChI=1S/C15H22S2/c1-9(2)11-8-15(4)10(3)6-5-7-12(15)14(17)13(11)16/h5,7,10-13,16H,1,6,8H2,2-4H3 |
| InChIKey | MVSVTZVAJFVSQS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|