C12H12F12O2 — CID 58587215
2-[[2-[difluoro(1,1,2-trifluoroprop-2-enoxy)methyl]-2,3,3,3-tetrafluoropropoxy]methyl]-1,1,1-trifluorobutane (PubChem CID 58587215) has the molecular formula C12H12F12O2 and a molecular weight of 416.20 g/mol. Its IUPAC name is 2-[[2-[difluoro(1,1,2-trifluoroprop-2-enoxy)methyl]-2,3,3,3-tetrafluoropropoxy]methyl]-1,1,1-trifluorobutane.
| Compound Name | 2-[[2-[difluoro(1,1,2-trifluoroprop-2-enoxy)methyl]-2,3,3,3-tetrafluoropropoxy]methyl]-1,1,1-trifluorobutane |
|---|---|
| PubChem CID | 58587215 |
| Molecular Formula | C12H12F12O2 |
| Molecular Weight | 416.20 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 2-[[2-[difluoro(1,1,2-trifluoroprop-2-enoxy)methyl]-2,3,3,3-tetrafluoropropoxy]methyl]-1,1,1-trifluorobutane |
| SMILES | C=C(F)C(F)(F)OC(F)(F)C(F)(COCC(CC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12F12O2/c1-3-7(9(15,16)17)4-25-5-8(14,11(20,21)22)12(23,24)26-10(18,19)6(2)13/h7H,2-5H2,1H3 |
| InChIKey | ICZSQCXAJHZYAJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.20 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |