About 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium
3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium (PubChem CID 58587275) has the molecular formula C8H13N2Zr-
and a molecular weight of 228.43 g/mol. Its IUPAC name is 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium.
Molecular Properties
| Compound Name | 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium |
| PubChem CID | 58587275 |
| Molecular Formula | C8H13N2Zr- |
| Molecular Weight | 228.43 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium |
| SMILES | [CH2-]C(C)C1=NN=C(CC)C1.[Zr] |
| InChI | InChI=1S/C8H13N2.Zr/c1-4-7-5-8(6(2)3)10-9-7;/h6H,2,4-5H2,1,3H3;/q-1; |
| InChIKey | IGZASVHYDOITCB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium?
The IUPAC name of 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium (CID 58587275) is 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium.
What is the SMILES notation for 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium?
The canonical SMILES for 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium is [CH2-]C(C)C1=NN=C(CC)C1.[Zr].
What is the InChIKey of 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium?
The InChIKey is IGZASVHYDOITCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N2.Zr/c1-4-7-5-8(6(2)3)10-9-7;/h6H,2,4-5H2,1,3H3;/q-1;.
What are the key properties of 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium?
3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium has a molecular weight of 228.43 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-propan-2-yl-4H-pyrazole;zirconium is sourced from PubChem (CID 58587275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).