C25H32N4O — CID 58587708
8-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2,6,7-triazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene (PubChem CID 58587708) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is 8-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2,6,7-triazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene.
| Compound Name | 8-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2,6,7-triazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 58587708 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 8-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2,6,7-triazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc(-c2c3c(nc4ccnn24)CCCCC3)cc1 |
| InChI | InChI=1S/C25H32N4O/c1-19-7-5-16-28(19)17-6-18-30-21-12-10-20(11-13-21)25-22-8-3-2-4-9-23(22)27-24-14-15-26-29(24)25/h10-15,19H,2-9,16-18H2,1H3/t19-/m1/s1 |
| InChIKey | UHPJTENJFZRKKW-LJQANCHMSA-N |
| XLogP | 4.92 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|