C25H21F3N6OS — CID 58587992
1-[3-methyl-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 58587992) has the molecular formula C25H21F3N6OS and a molecular weight of 510.55 g/mol. Its IUPAC name is 1-[3-methyl-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[3-methyl-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 58587992 |
| Molecular Formula | C25H21F3N6OS |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 1-[3-methyl-4-[[3-[2-(methylamino)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | CNc1nccc(-c2cccnc2Oc2ccc(NC(=S)Nc3cccc(C(F)(F)F)c3)cc2C)n1 |
| InChI | InChI=1S/C25H21F3N6OS/c1-15-13-18(33-24(36)32-17-6-3-5-16(14-17)25(26,27)28)8-9-21(15)35-22-19(7-4-11-30-22)20-10-12-31-23(29-2)34-20/h3-14H,1-2H3,(H,29,31,34)(H2,32,33,36) |
| InChIKey | YXONJQOXRWMECP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|