C30H39F3N4O4 — CID 58588649
tert-butyl N-[2-[4-[(6R,9aS)-2-[6-(trifluoromethyl)pyridine-3-carbonyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]ethyl]carbamate (PubChem CID 58588649) has the molecular formula C30H39F3N4O4 and a molecular weight of 576.66 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(6R,9aS)-2-[6-(trifluoromethyl)pyridine-3-carbonyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(6R,9aS)-2-[6-(trifluoromethyl)pyridine-3-carbonyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 58588649 |
| Molecular Formula | C30H39F3N4O4 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | tert-butyl N-[2-[4-[(6R,9aS)-2-[6-(trifluoromethyl)pyridine-3-carbonyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]ethyl]carbamate |
| SMILES | Cc1c(OCCNC(=O)OC(C)(C)C)ccc([C@H]2CCC[C@H]3CN(C(=O)c4ccc(C(F)(F)F)nc4)CCN32)c1C |
| InChI | InChI=1S/C30H39F3N4O4/c1-19-20(2)25(40-16-13-34-28(39)41-29(3,4)5)11-10-23(19)24-8-6-7-22-18-36(14-15-37(22)24)27(38)21-9-12-26(35-17-21)30(31,32)33/h9-12,17,22,24H,6-8,13-16,18H2,1-5H3,(H,34,39)/t22-,24+/m0/s1 |
| InChIKey | LGVSFIIOLFRLGX-LADGPHEKSA-N |
| XLogP | 5.67 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|