C26H33F3N4O2 — CID 58588881
[(6R,9aS)-6-[2,3-dimethyl-4-[2-(methylamino)ethoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 58588881) has the molecular formula C26H33F3N4O2 and a molecular weight of 490.57 g/mol. Its IUPAC name is [(6R,9aS)-6-[2,3-dimethyl-4-[2-(methylamino)ethoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(6R,9aS)-6-[2,3-dimethyl-4-[2-(methylamino)ethoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 58588881 |
| Molecular Formula | C26H33F3N4O2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | [(6R,9aS)-6-[2,3-dimethyl-4-[2-(methylamino)ethoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | CNCCOc1ccc([C@H]2CCC[C@H]3CN(C(=O)c4ccc(C(F)(F)F)nc4)CCN32)c(C)c1C |
| InChI | InChI=1S/C26H33F3N4O2/c1-17-18(2)23(35-14-11-30-3)9-8-21(17)22-6-4-5-20-16-32(12-13-33(20)22)25(34)19-7-10-24(31-15-19)26(27,28)29/h7-10,15,20,22,30H,4-6,11-14,16H2,1-3H3/t20-,22+/m0/s1 |
| InChIKey | BZDVJAFPNRAXAQ-RBBKRZOGSA-N |
| XLogP | 4.37 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|