C30H42ClN3O3 — CID 58589082
(3S)-1-[3-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propyl]pyrrolidin-3-ol (PubChem CID 58589082) has the molecular formula C30H42ClN3O3 and a molecular weight of 528.14 g/mol. Its IUPAC name is (3S)-1-[3-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propyl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[3-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 58589082 |
| Molecular Formula | C30H42ClN3O3 |
| Molecular Weight | 528.14 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | (3S)-1-[3-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propyl]pyrrolidin-3-ol |
| SMILES | COc1cc(N2CCN3[C@@H](CCC[C@@H]3c3ccc(OCCCN4CC[C@H](O)C4)c(C)c3C)C2)ccc1Cl |
| InChI | InChI=1S/C30H42ClN3O3/c1-21-22(2)29(37-17-5-13-32-14-12-25(35)20-32)11-9-26(21)28-7-4-6-24-19-33(15-16-34(24)28)23-8-10-27(31)30(18-23)36-3/h8-11,18,24-25,28,35H,4-7,12-17,19-20H2,1-3H3/t24-,25-,28+/m0/s1 |
| InChIKey | OKJQSOCIWLJTHM-PNIUZAESSA-N |
| XLogP | 5.22 |
| TPSA | 48.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.14 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|