C28H32F3N5O2 — CID 58589191
[(1R,4R)-5-[(1S)-1-[2,3-dimethyl-4-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]ethyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 58589191) has the molecular formula C28H32F3N5O2 and a molecular weight of 527.59 g/mol. Its IUPAC name is [(1R,4R)-5-[(1S)-1-[2,3-dimethyl-4-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]ethyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(1R,4R)-5-[(1S)-1-[2,3-dimethyl-4-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]ethyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 58589191 |
| Molecular Formula | C28H32F3N5O2 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | [(1R,4R)-5-[(1S)-1-[2,3-dimethyl-4-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]ethyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1c(OCCCn2cncn2)ccc([C@H](C)N2C[C@H]3C[C@@H]2CN3C(=O)c2ccc(C(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C28H32F3N5O2/c1-18-19(2)26(38-12-4-11-34-17-32-16-33-34)10-9-25(18)20(3)35-14-24-13-23(35)15-36(24)27(37)21-5-7-22(8-6-21)28(29,30)31/h5-10,16-17,20,23-24H,4,11-15H2,1-3H3/t20-,23+,24+/m0/s1 |
| InChIKey | CSZTWXAKQMHQGT-TUACAJSNSA-N |
| XLogP | 5.04 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|