C32H32F3N3O4 — CID 58589199
2-[3-[2,3-dimethyl-4-[[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]methyl]phenoxy]propyl]isoindole-1,3-dione (PubChem CID 58589199) has the molecular formula C32H32F3N3O4 and a molecular weight of 579.62 g/mol. Its IUPAC name is 2-[3-[2,3-dimethyl-4-[[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]methyl]phenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[2,3-dimethyl-4-[[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]methyl]phenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58589199 |
| Molecular Formula | C32H32F3N3O4 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 2-[3-[2,3-dimethyl-4-[[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]methyl]phenoxy]propyl]isoindole-1,3-dione |
| SMILES | Cc1c(CN2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)ccc(OCCCN2C(=O)c3ccccc3C2=O)c1C |
| InChI | InChI=1S/C32H32F3N3O4/c1-21-22(2)28(42-19-5-14-38-30(40)26-6-3-4-7-27(26)31(38)41)13-10-24(21)20-36-15-17-37(18-16-36)29(39)23-8-11-25(12-9-23)32(33,34)35/h3-4,6-13H,5,14-20H2,1-2H3 |
| InChIKey | ZECFKWYRBLNKTJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|