About 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium
4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium (PubChem CID 58589478) has the molecular formula C7H7NW4Y-2
and a molecular weight of 929.41 g/mol. Its IUPAC name is 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium.
Molecular Properties
| Compound Name | 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium |
| PubChem CID | 58589478 |
| Molecular Formula | C7H7NW4Y-2 |
| Molecular Weight | 929.41 g/mol |
| Exact Mass | 929.77 |
| IUPAC Name | 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium |
| SMILES | Cc1[c-]c(C)n[c-]c1.[W].[W].[W].[W].[Y] |
| InChI | InChI=1S/C7H7N.4W.Y/c1-6-3-4-8-7(2)5-6;;;;;/h3H,1-2H3;;;;;/q-2;;;;; |
| InChIKey | ZQRDAPGHRXVUQN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 929.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium?
The IUPAC name of 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium (CID 58589478) is 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium.
What is the SMILES notation for 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium?
The canonical SMILES for 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium is Cc1[c-]c(C)n[c-]c1.[W].[W].[W].[W].[Y].
What is the InChIKey of 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium?
The InChIKey is ZQRDAPGHRXVUQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N.4W.Y/c1-6-3-4-8-7(2)5-6;;;;;/h3H,1-2H3;;;;;/q-2;;;;;.
What are the key properties of 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium?
4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium has a molecular weight of 929.41 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-2,5-dihydropyridine-2,5-diide;tungsten;yttrium is sourced from PubChem (CID 58589478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).