C8H11F2NO3 — CID 58590238
3,4-difluoro-1-(2-hydroxyethyl)-3,4-dimethylpyrrolidine-2,5-dione (PubChem CID 58590238) has the molecular formula C8H11F2NO3 and a molecular weight of 207.18 g/mol. Its IUPAC name is 3,4-difluoro-1-(2-hydroxyethyl)-3,4-dimethylpyrrolidine-2,5-dione.
| Compound Name | 3,4-difluoro-1-(2-hydroxyethyl)-3,4-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58590238 |
| Molecular Formula | C8H11F2NO3 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 3,4-difluoro-1-(2-hydroxyethyl)-3,4-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1(F)C(=O)N(CCO)C(=O)C1(C)F |
| InChI | InChI=1S/C8H11F2NO3/c1-7(9)5(13)11(3-4-12)6(14)8(7,2)10/h12H,3-4H2,1-2H3 |
| InChIKey | MBZMVSKTTNHFET-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|