About 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran
2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran (PubChem CID 58590252) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran |
| PubChem CID | 58590252 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran |
| SMILES | CC1Oc2c(OCC3CO3)cccc2C1C |
| InChI | InChI=1S/C13H16O3/c1-8-9(2)16-13-11(8)4-3-5-12(13)15-7-10-6-14-10/h3-5,8-10H,6-7H2,1-2H3 |
| InChIKey | BBQFPSUBCRRICP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran?
The IUPAC name of 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran (CID 58590252) is 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran?
The canonical SMILES for 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran is CC1Oc2c(OCC3CO3)cccc2C1C.
What is the InChIKey of 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran?
The InChIKey is BBQFPSUBCRRICP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-8-9(2)16-13-11(8)4-3-5-12(13)15-7-10-6-14-10/h3-5,8-10H,6-7H2,1-2H3.
What are the key properties of 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran?
2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran has a molecular weight of 220.27 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-7-(oxiran-2-ylmethoxy)-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 58590252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).