C15H18FN5 — CID 58590404
6-(1-fluoroethyl)-2-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 58590404) has the molecular formula C15H18FN5 and a molecular weight of 287.34 g/mol. Its IUPAC name is 6-(1-fluoroethyl)-2-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1-fluoroethyl)-2-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58590404 |
| Molecular Formula | C15H18FN5 |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 6-(1-fluoroethyl)-2-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(F)c1nc(N)nc(NC2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C15H18FN5/c1-9(16)13-19-14(17)21-15(20-13)18-12-8-4-6-10-5-2-3-7-11(10)12/h2-3,5,7,9,12H,4,6,8H2,1H3,(H3,17,18,19,20,21) |
| InChIKey | RGJNSAJDECMUHM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |