C17H22FN5 — CID 58590409
6-(2-fluoropropan-2-yl)-2-N-[(1R,2S)-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 58590409) has the molecular formula C17H22FN5 and a molecular weight of 315.40 g/mol. Its IUPAC name is 6-(2-fluoropropan-2-yl)-2-N-[(1R,2S)-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-fluoropropan-2-yl)-2-N-[(1R,2S)-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58590409 |
| Molecular Formula | C17H22FN5 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 6-(2-fluoropropan-2-yl)-2-N-[(1R,2S)-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@H]1CCc2ccccc2[C@@H]1Nc1nc(N)nc(C(C)(C)F)n1 |
| InChI | InChI=1S/C17H22FN5/c1-10-8-9-11-6-4-5-7-12(11)13(10)20-16-22-14(17(2,3)18)21-15(19)23-16/h4-7,10,13H,8-9H2,1-3H3,(H3,19,20,21,22,23)/t10-,13+/m0/s1 |
| InChIKey | BEVCALTXKNSIAZ-GXFFZTMASA-N |
| XLogP | 3.39 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |