C16H20FN5 — CID 58590417
6-(1-fluoroethyl)-2-N-(2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 58590417) has the molecular formula C16H20FN5 and a molecular weight of 301.37 g/mol. Its IUPAC name is 6-(1-fluoroethyl)-2-N-(2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1-fluoroethyl)-2-N-(2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58590417 |
| Molecular Formula | C16H20FN5 |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 6-(1-fluoroethyl)-2-N-(2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(F)c1nc(N)nc(NC2c3ccccc3CCC2C)n1 |
| InChI | InChI=1S/C16H20FN5/c1-9-7-8-11-5-3-4-6-12(11)13(9)19-16-21-14(10(2)17)20-15(18)22-16/h3-6,9-10,13H,7-8H2,1-2H3,(H3,18,19,20,21,22) |
| InChIKey | ZTJZCGWUTGCBGC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |