C33H42N4O4 — CID 58590763
1-(2,2-dimethylpropanoyl)-N-[(2R)-1-[3-[(2-hydroxyphenyl)methylamino]propylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 58590763) has the molecular formula C33H42N4O4 and a molecular weight of 558.72 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-[(2R)-1-[3-[(2-hydroxyphenyl)methylamino]propylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-[(2R)-1-[3-[(2-hydroxyphenyl)methylamino]propylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58590763 |
| Molecular Formula | C33H42N4O4 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-[(2R)-1-[3-[(2-hydroxyphenyl)methylamino]propylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C(=O)N1CCCC1C(=O)N[C@H](Cc1ccc2ccccc2c1)C(=O)NCCCNCc1ccccc1O |
| InChI | InChI=1S/C33H42N4O4/c1-33(2,3)32(41)37-19-8-13-28(37)31(40)36-27(21-23-15-16-24-10-4-5-11-25(24)20-23)30(39)35-18-9-17-34-22-26-12-6-7-14-29(26)38/h4-7,10-12,14-16,20,27-28,34,38H,8-9,13,17-19,21-22H2,1-3H3,(H,35,39)(H,36,40)/t27-,28?/m1/s1 |
| InChIKey | WZQQJJCRWPHYFI-QXPUDEPPSA-N |
| XLogP | 3.91 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|