C18H24FNO3S — CID 58591001
tert-butyl (4S,5R)-4-(fluoromethyl)-5-(4-methanethioylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 58591001) has the molecular formula C18H24FNO3S and a molecular weight of 353.46 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-(fluoromethyl)-5-(4-methanethioylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-(fluoromethyl)-5-(4-methanethioylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 58591001 |
| Molecular Formula | C18H24FNO3S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | tert-butyl (4S,5R)-4-(fluoromethyl)-5-(4-methanethioylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CF)[C@@H](c2ccc(C=S)cc2)OC1(C)C |
| InChI | InChI=1S/C18H24FNO3S/c1-17(2,3)23-16(21)20-14(10-19)15(22-18(20,4)5)13-8-6-12(11-24)7-9-13/h6-9,11,14-15H,10H2,1-5H3/t14-,15-/m1/s1 |
| InChIKey | ZIIXSSMNACKXOC-HUUCEWRRSA-N |
| XLogP | 4.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|