About 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate
2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate (PubChem CID 585911) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate.
Molecular Properties
| Compound Name | 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate |
| PubChem CID | 585911 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate |
| SMILES | CC1=CCC(C(C)(C)OC(=O)CC(C)C)CC1 |
| InChI | InChI=1S/C15H26O2/c1-11(2)10-14(16)17-15(4,5)13-8-6-12(3)7-9-13/h6,11,13H,7-10H2,1-5H3 |
| InChIKey | XRADSECIALQFFY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate?
The IUPAC name of 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate (CID 585911) is 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate.
What is the SMILES notation for 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate?
The canonical SMILES for 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate is CC1=CCC(C(C)(C)OC(=O)CC(C)C)CC1.
What is the InChIKey of 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate?
The InChIKey is XRADSECIALQFFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-11(2)10-14(16)17-15(4,5)13-8-6-12(3)7-9-13/h6,11,13H,7-10H2,1-5H3.
What are the key properties of 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate?
2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate has a molecular weight of 238.37 g/mol, XLogP of 4.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl 3-methylbutanoate is sourced from PubChem (CID 585911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).