About 3,5,7-trimethyl-4H-diazepine
3,5,7-trimethyl-4H-diazepine (PubChem CID 585913) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 3,5,7-trimethyl-4H-diazepine.
Molecular Properties
| Compound Name | 3,5,7-trimethyl-4H-diazepine |
| PubChem CID | 585913 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 3,5,7-trimethyl-4H-diazepine |
| SMILES | CC1=CC(C)=NN=C(C)C1 |
| InChI | InChI=1S/C8H12N2/c1-6-4-7(2)9-10-8(3)5-6/h4H,5H2,1-3H3 |
| InChIKey | KTRYUGCCKRHLIU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5,7-trimethyl-4H-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,7-trimethyl-4H-diazepine?
The IUPAC name of 3,5,7-trimethyl-4H-diazepine (CID 585913) is 3,5,7-trimethyl-4H-diazepine.
What is the SMILES notation for 3,5,7-trimethyl-4H-diazepine?
The canonical SMILES for 3,5,7-trimethyl-4H-diazepine is CC1=CC(C)=NN=C(C)C1.
What is the InChIKey of 3,5,7-trimethyl-4H-diazepine?
The InChIKey is KTRYUGCCKRHLIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-6-4-7(2)9-10-8(3)5-6/h4H,5H2,1-3H3.
What are the key properties of 3,5,7-trimethyl-4H-diazepine?
3,5,7-trimethyl-4H-diazepine has a molecular weight of 136.20 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,7-trimethyl-4H-diazepine is sourced from PubChem (CID 585913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).