C11H11ClN4O2 — CID 58591624
ethyl 3-amino-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxylate (PubChem CID 58591624) has the molecular formula C11H11ClN4O2 and a molecular weight of 266.69 g/mol. Its IUPAC name is ethyl 3-amino-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxylate.
| Compound Name | ethyl 3-amino-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 58591624 |
| Molecular Formula | C11H11ClN4O2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | ethyl 3-amino-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(N)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C11H11ClN4O2/c1-2-18-11(17)8-6-9(13)15-16(8)10-7(12)4-3-5-14-10/h3-6H,2H2,1H3,(H2,13,15) |
| InChIKey | NYBLAKSBDNAUDZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |