About ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate
ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate (PubChem CID 58591912) has the molecular formula C16H15F6NO4S
and a molecular weight of 431.35 g/mol. Its IUPAC name is ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate.
Molecular Properties
| Compound Name | ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate |
| PubChem CID | 58591912 |
| Molecular Formula | C16H15F6NO4S |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)(C#N)CCS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F6NO4S/c1-3-27-13(24)14(2,9-23)4-5-28(25,26)12-7-10(15(17,18)19)6-11(8-12)16(20,21)22/h6-8H,3-5H2,1-2H3 |
| InChIKey | DTMCZDIZRTYELP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate?
The IUPAC name of ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate (CID 58591912) is ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate.
What is the SMILES notation for ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate?
The canonical SMILES for ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate is CCOC(=O)C(C)(C#N)CCS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate?
The InChIKey is DTMCZDIZRTYELP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F6NO4S/c1-3-27-13(24)14(2,9-23)4-5-28(25,26)12-7-10(15(17,18)19)6-11(8-12)16(20,21)22/h6-8H,3-5H2,1-2H3.
What are the key properties of ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate?
ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate has a molecular weight of 431.35 g/mol, XLogP of 3.98, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2-cyano-2-methylbutanoate is sourced from PubChem (CID 58591912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).