C14H16F6O4 — CID 58591922
1,1,1,3,3,3-hexafluoropropan-2-yl 2-oxo-1-(3-oxobutyl)cyclohexane-1-carboxylate (PubChem CID 58591922) has the molecular formula C14H16F6O4 and a molecular weight of 362.27 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-oxo-1-(3-oxobutyl)cyclohexane-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-oxo-1-(3-oxobutyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58591922 |
| Molecular Formula | C14H16F6O4 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-oxo-1-(3-oxobutyl)cyclohexane-1-carboxylate |
| SMILES | CC(=O)CCC1(C(=O)OC(C(F)(F)F)C(F)(F)F)CCCCC1=O |
| InChI | InChI=1S/C14H16F6O4/c1-8(21)5-7-12(6-3-2-4-9(12)22)11(23)24-10(13(15,16)17)14(18,19)20/h10H,2-7H2,1H3 |
| InChIKey | QQBXSNXWFYOYQZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|