C16H15Cl2N — CID 58591995
(1R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 58591995) has the molecular formula C16H15Cl2N and a molecular weight of 292.21 g/mol. Its IUPAC name is (1R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 58591995 |
| Molecular Formula | C16H15Cl2N |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | (1R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | N[C@@H]1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C16H15Cl2N/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13/h1-5,7,9,11,16H,6,8,19H2/t11?,16-/m1/s1 |
| InChIKey | SRPXSILJHWNFMK-WVQRXBFSSA-N |
| XLogP | 4.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |