About 5-imino-1-N-methylhexane-1,4-diamine
5-imino-1-N-methylhexane-1,4-diamine (PubChem CID 58592142) has the molecular formula C7H17N3
and a molecular weight of 143.23 g/mol. Its IUPAC name is 5-imino-1-N-methylhexane-1,4-diamine.
Molecular Properties
| Compound Name | 5-imino-1-N-methylhexane-1,4-diamine |
| PubChem CID | 58592142 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | 5-imino-1-N-methylhexane-1,4-diamine |
| SMILES | [H]/N=C(\C)C(N)CCCNC |
| InChI | InChI=1S/C7H17N3/c1-6(8)7(9)4-3-5-10-2/h7-8,10H,3-5,9H2,1-2H3/b8-6+ |
| InChIKey | GDWLMXOLKUUPCD-SOFGYWHQSA-N |
| XLogP | 0.35 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-imino-1-N-methylhexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-imino-1-N-methylhexane-1,4-diamine?
The IUPAC name of 5-imino-1-N-methylhexane-1,4-diamine (CID 58592142) is 5-imino-1-N-methylhexane-1,4-diamine.
What is the SMILES notation for 5-imino-1-N-methylhexane-1,4-diamine?
The canonical SMILES for 5-imino-1-N-methylhexane-1,4-diamine is [H]/N=C(\C)C(N)CCCNC.
What is the InChIKey of 5-imino-1-N-methylhexane-1,4-diamine?
The InChIKey is GDWLMXOLKUUPCD-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H17N3/c1-6(8)7(9)4-3-5-10-2/h7-8,10H,3-5,9H2,1-2H3/b8-6+.
What are the key properties of 5-imino-1-N-methylhexane-1,4-diamine?
5-imino-1-N-methylhexane-1,4-diamine has a molecular weight of 143.23 g/mol, XLogP of 0.35, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-imino-1-N-methylhexane-1,4-diamine is sourced from PubChem (CID 58592142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).