C12H18O3 — CID 58592214
(1R,8S,10S)-10,11,11-trimethyl-5,7-dioxatricyclo[6.3.0.02,6]undecan-4-one (PubChem CID 58592214) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1R,8S,10S)-10,11,11-trimethyl-5,7-dioxatricyclo[6.3.0.02,6]undecan-4-one.
| Compound Name | (1R,8S,10S)-10,11,11-trimethyl-5,7-dioxatricyclo[6.3.0.02,6]undecan-4-one |
|---|---|
| PubChem CID | 58592214 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1R,8S,10S)-10,11,11-trimethyl-5,7-dioxatricyclo[6.3.0.02,6]undecan-4-one |
| SMILES | C[C@H]1C[C@@H]2OC3OC(=O)CC3[C@@H]2C1(C)C |
| InChI | InChI=1S/C12H18O3/c1-6-4-8-10(12(6,2)3)7-5-9(13)15-11(7)14-8/h6-8,10-11H,4-5H2,1-3H3/t6-,7?,8-,10-,11?/m0/s1 |
| InChIKey | CXSMJYPFSHMALA-BCAIYFIWSA-N |
| XLogP | 1.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |