About 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane
8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane (PubChem CID 58592530) has the molecular formula C21H24O2S
and a molecular weight of 340.49 g/mol. Its IUPAC name is 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane |
| PubChem CID | 58592530 |
| Molecular Formula | C21H24O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane |
| SMILES | c1ccc(CSCC2(c3ccccc3)CCC3(C2)OCCO3)cc1 |
| InChI | InChI=1S/C21H24O2S/c1-3-7-18(8-4-1)15-24-17-20(19-9-5-2-6-10-19)11-12-21(16-20)22-13-14-23-21/h1-10H,11-17H2 |
| InChIKey | CTMQUWHKZPHWOL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane?
The IUPAC name of 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane (CID 58592530) is 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane.
What is the SMILES notation for 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane?
The canonical SMILES for 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane is c1ccc(CSCC2(c3ccccc3)CCC3(C2)OCCO3)cc1.
What is the InChIKey of 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane?
The InChIKey is CTMQUWHKZPHWOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O2S/c1-3-7-18(8-4-1)15-24-17-20(19-9-5-2-6-10-19)11-12-21(16-20)22-13-14-23-21/h1-10H,11-17H2.
What are the key properties of 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane?
8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane has a molecular weight of 340.49 g/mol, XLogP of 4.78, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(benzylsulfanylmethyl)-8-phenyl-1,4-dioxaspiro[4.4]nonane is sourced from PubChem (CID 58592530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).