About 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole
2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole (PubChem CID 58592540) has the molecular formula C11H15NS
and a molecular weight of 193.31 g/mol. Its IUPAC name is 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole |
| PubChem CID | 58592540 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole |
| SMILES | CC(C)CC1=NC2C=CC=CC2S1 |
| InChI | InChI=1S/C11H15NS/c1-8(2)7-11-12-9-5-3-4-6-10(9)13-11/h3-6,8-10H,7H2,1-2H3 |
| InChIKey | BNVPPEKPRBYSLB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole?
The IUPAC name of 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole (CID 58592540) is 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole.
What is the SMILES notation for 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole?
The canonical SMILES for 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole is CC(C)CC1=NC2C=CC=CC2S1.
What is the InChIKey of 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole?
The InChIKey is BNVPPEKPRBYSLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NS/c1-8(2)7-11-12-9-5-3-4-6-10(9)13-11/h3-6,8-10H,7H2,1-2H3.
What are the key properties of 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole?
2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole has a molecular weight of 193.31 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropyl)-3a,7a-dihydro-1,3-benzothiazole is sourced from PubChem (CID 58592540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).