C24H24S3 — CID 585929
2,4,6-trimethyl-2,4,6-triphenyl-1,3,5-trithiane (PubChem CID 585929) has the molecular formula C24H24S3 and a molecular weight of 408.66 g/mol. Its IUPAC name is 2,4,6-trimethyl-2,4,6-triphenyl-1,3,5-trithiane.
| Compound Name | 2,4,6-trimethyl-2,4,6-triphenyl-1,3,5-trithiane |
|---|---|
| PubChem CID | 585929 |
| Molecular Formula | C24H24S3 |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2,4,6-trimethyl-2,4,6-triphenyl-1,3,5-trithiane |
| SMILES | CC1(c2ccccc2)SC(C)(c2ccccc2)SC(C)(c2ccccc2)S1 |
| InChI | InChI=1S/C24H24S3/c1-22(19-13-7-4-8-14-19)25-23(2,20-15-9-5-10-16-20)27-24(3,26-22)21-17-11-6-12-18-21/h4-18H,1-3H3 |
| InChIKey | TXNAAJVHWOBHAM-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |