About 3,3-dimethylpiperidine-2,4-dione
3,3-dimethylpiperidine-2,4-dione (PubChem CID 58592978) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 3,3-dimethylpiperidine-2,4-dione.
Molecular Properties
| Compound Name | 3,3-dimethylpiperidine-2,4-dione |
| PubChem CID | 58592978 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 3,3-dimethylpiperidine-2,4-dione |
| SMILES | CC1(C)C(=O)CCNC1=O |
| InChI | InChI=1S/C7H11NO2/c1-7(2)5(9)3-4-8-6(7)10/h3-4H2,1-2H3,(H,8,10) |
| InChIKey | VXJPHMNYLXKYRP-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethylpiperidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylpiperidine-2,4-dione?
The IUPAC name of 3,3-dimethylpiperidine-2,4-dione (CID 58592978) is 3,3-dimethylpiperidine-2,4-dione.
What is the SMILES notation for 3,3-dimethylpiperidine-2,4-dione?
The canonical SMILES for 3,3-dimethylpiperidine-2,4-dione is CC1(C)C(=O)CCNC1=O.
What is the InChIKey of 3,3-dimethylpiperidine-2,4-dione?
The InChIKey is VXJPHMNYLXKYRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-7(2)5(9)3-4-8-6(7)10/h3-4H2,1-2H3,(H,8,10).
What are the key properties of 3,3-dimethylpiperidine-2,4-dione?
3,3-dimethylpiperidine-2,4-dione has a molecular weight of 141.17 g/mol, XLogP of 0.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylpiperidine-2,4-dione is sourced from PubChem (CID 58592978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).