C24H38INO4Si — CID 58593151
(3R,3aS,6aR)-3-[(1R)-1-[butyl-di(propan-2-yl)silyl]oxyethyl]-1-[(4-iodophenyl)methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one (PubChem CID 58593151) has the molecular formula C24H38INO4Si and a molecular weight of 559.56 g/mol. Its IUPAC name is (3R,3aS,6aR)-3-[(1R)-1-[butyl-di(propan-2-yl)silyl]oxyethyl]-1-[(4-iodophenyl)methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one.
| Compound Name | (3R,3aS,6aR)-3-[(1R)-1-[butyl-di(propan-2-yl)silyl]oxyethyl]-1-[(4-iodophenyl)methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
|---|---|
| PubChem CID | 58593151 |
| Molecular Formula | C24H38INO4Si |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | (3R,3aS,6aR)-3-[(1R)-1-[butyl-di(propan-2-yl)silyl]oxyethyl]-1-[(4-iodophenyl)methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
| SMILES | CCCC[Si](O[C@H](C)[C@@H]1ON(Cc2ccc(I)cc2)[C@H]2C(=O)OC[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H38INO4Si/c1-7-8-13-31(16(2)3,17(4)5)30-18(6)23-21-15-28-24(27)22(21)26(29-23)14-19-9-11-20(25)12-10-19/h9-12,16-18,21-23H,7-8,13-15H2,1-6H3/t18-,21-,22-,23+/m1/s1 |
| InChIKey | CZTFRBBUBAVSGU-HWHRFOGPSA-N |
| XLogP | 5.92 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|