C29H37NO4Si — CID 58593172
(3R,3aR,6aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one (PubChem CID 58593172) has the molecular formula C29H37NO4Si and a molecular weight of 491.70 g/mol. Its IUPAC name is (3R,3aR,6aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one.
| Compound Name | (3R,3aR,6aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
|---|---|
| PubChem CID | 58593172 |
| Molecular Formula | C29H37NO4Si |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | (3R,3aR,6aS)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one |
| SMILES | Cc1ccc(C#Cc2ccc(CN3O[C@@H]([C@H](C)O[Si](C)(C)C(C)(C)C)[C@H]4COC(=O)[C@H]43)cc2)cc1 |
| InChI | InChI=1S/C29H37NO4Si/c1-20-8-10-22(11-9-20)12-13-23-14-16-24(17-15-23)18-30-26-25(19-32-28(26)31)27(33-30)21(2)34-35(6,7)29(3,4)5/h8-11,14-17,21,25-27H,18-19H2,1-7H3/t21-,25-,26-,27-/m0/s1 |
| InChIKey | NUKIIYLGJNJSGI-ZYEMSUIVSA-N |
| XLogP | 5.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|