C23H21NO6 — CID 58593216
4-[2-[4-[[(3R,3aR,6aS)-3-[(1S)-1-hydroxyethyl]-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-1-yl]methyl]phenyl]ethynyl]benzoic acid (PubChem CID 58593216) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is 4-[2-[4-[[(3R,3aR,6aS)-3-[(1S)-1-hydroxyethyl]-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-1-yl]methyl]phenyl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[4-[[(3R,3aR,6aS)-3-[(1S)-1-hydroxyethyl]-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-1-yl]methyl]phenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 58593216 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-[2-[4-[[(3R,3aR,6aS)-3-[(1S)-1-hydroxyethyl]-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-1-yl]methyl]phenyl]ethynyl]benzoic acid |
| SMILES | C[C@H](O)[C@@H]1ON(Cc2ccc(C#Cc3ccc(C(=O)O)cc3)cc2)[C@@H]2C(=O)OC[C@H]12 |
| InChI | InChI=1S/C23H21NO6/c1-14(25)21-19-13-29-23(28)20(19)24(30-21)12-17-6-4-15(5-7-17)2-3-16-8-10-18(11-9-16)22(26)27/h4-11,14,19-21,25H,12-13H2,1H3,(H,26,27)/t14-,19-,20-,21-/m0/s1 |
| InChIKey | NRPMBQIVXKLFAI-CXTHYWKRSA-N |
| XLogP | 1.82 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|